C11H16F3NO3S — CID 58100593
2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1,1-difluoro-2-oxoethanesulfonyl fluoride (PubChem CID 58100593) has the molecular formula C11H16F3NO3S and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1,1-difluoro-2-oxoethanesulfonyl fluoride.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1,1-difluoro-2-oxoethanesulfonyl fluoride |
|---|---|
| PubChem CID | 58100593 |
| Molecular Formula | C11H16F3NO3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1,1-difluoro-2-oxoethanesulfonyl fluoride |
| SMILES | O=C(N1CCC2CCCCC2C1)C(F)(F)S(=O)(=O)F |
| InChI | InChI=1S/C11H16F3NO3S/c12-11(13,19(14,17)18)10(16)15-6-5-8-3-1-2-4-9(8)7-15/h8-9H,1-7H2 |
| InChIKey | ROXYGVNYZQAJGR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |