C21H34O2 — CID 58100916
(4bS,8aR,10aR)-10a-ethyl-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] (PubChem CID 58100916) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (4bS,8aR,10aR)-10a-ethyl-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane].
| Compound Name | (4bS,8aR,10aR)-10a-ethyl-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 58100916 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (4bS,8aR,10aR)-10a-ethyl-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] |
| SMILES | CC[C@]12CCCC=C1[C@@]1(C)CCC3(OCCO3)C(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C21H34O2/c1-5-20-10-7-6-8-17(20)19(4)12-13-21(22-14-15-23-21)18(2,3)16(19)9-11-20/h8,16H,5-7,9-15H2,1-4H3/t16-,19-,20+/m0/s1 |
| InChIKey | HEAFFMQUEZVOLK-FFZOFVMBSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|