About ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate
ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate (PubChem CID 58100933) has the molecular formula C18H22N2O2SSi
and a molecular weight of 358.54 g/mol. Its IUPAC name is ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate |
| PubChem CID | 58100933 |
| Molecular Formula | C18H22N2O2SSi |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc([Si](C)(C)C)ccc2n1Cc1nccs1 |
| InChI | InChI=1S/C18H22N2O2SSi/c1-5-22-18(21)16-11-13-10-14(24(2,3)4)6-7-15(13)20(16)12-17-19-8-9-23-17/h6-11H,5,12H2,1-4H3 |
| InChIKey | ZGEPEHIXNJNTJP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate?
The IUPAC name of ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate (CID 58100933) is ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate.
What is the SMILES notation for ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate?
The canonical SMILES for ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate is CCOC(=O)c1cc2cc([Si](C)(C)C)ccc2n1Cc1nccs1.
What is the InChIKey of ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate?
The InChIKey is ZGEPEHIXNJNTJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2SSi/c1-5-22-18(21)16-11-13-10-14(24(2,3)4)6-7-15(13)20(16)12-17-19-8-9-23-17/h6-11H,5,12H2,1-4H3.
What are the key properties of ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate?
ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate has a molecular weight of 358.54 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(1,3-thiazol-2-ylmethyl)-5-trimethylsilylindole-2-carboxylate is sourced from PubChem (CID 58100933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).