About 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium
2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium (PubChem CID 58101895) has the molecular formula C7H12N2OSY-2
and a molecular weight of 261.16 g/mol. Its IUPAC name is 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium.
Molecular Properties
| Compound Name | 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium |
| PubChem CID | 58101895 |
| Molecular Formula | C7H12N2OSY-2 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium |
| SMILES | [CH2-]C.[CH2-]CC1SC(N)=NC1=O.[Y] |
| InChI | InChI=1S/C5H7N2OS.C2H5.Y/c1-2-3-4(8)7-5(6)9-3;1-2;/h3H,1-2H2,(H2,6,7,8);1H2,2H3;/q2*-1; |
| InChIKey | YRLUNXIBAZQXLY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium?
The IUPAC name of 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium (CID 58101895) is 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium.
What is the SMILES notation for 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium?
The canonical SMILES for 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium is [CH2-]C.[CH2-]CC1SC(N)=NC1=O.[Y].
What is the InChIKey of 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium?
The InChIKey is YRLUNXIBAZQXLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N2OS.C2H5.Y/c1-2-3-4(8)7-5(6)9-3;1-2;/h3H,1-2H2,(H2,6,7,8);1H2,2H3;/q2*-1;.
What are the key properties of 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium?
2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium has a molecular weight of 261.16 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-ethyl-1,3-thiazol-4-one;ethane;yttrium is sourced from PubChem (CID 58101895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).