About ethane;1-(3-oxobutyl)piperidin-4-one;yttrium
ethane;1-(3-oxobutyl)piperidin-4-one;yttrium (PubChem CID 58101920) has the molecular formula C11H19NO2Y-2
and a molecular weight of 286.18 g/mol. Its IUPAC name is ethane;1-(3-oxobutyl)piperidin-4-one;yttrium.
Molecular Properties
| Compound Name | ethane;1-(3-oxobutyl)piperidin-4-one;yttrium |
| PubChem CID | 58101920 |
| Molecular Formula | C11H19NO2Y-2 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | ethane;1-(3-oxobutyl)piperidin-4-one;yttrium |
| SMILES | [CH2-]C.[CH2-]C(=O)CCN1CCC(=O)CC1.[Y] |
| InChI | InChI=1S/C9H14NO2.C2H5.Y/c1-8(11)2-5-10-6-3-9(12)4-7-10;1-2;/h1-7H2;1H2,2H3;/q2*-1; |
| InChIKey | HCGRRWMMRLXYIP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(3-oxobutyl)piperidin-4-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(3-oxobutyl)piperidin-4-one;yttrium?
The IUPAC name of ethane;1-(3-oxobutyl)piperidin-4-one;yttrium (CID 58101920) is ethane;1-(3-oxobutyl)piperidin-4-one;yttrium.
What is the SMILES notation for ethane;1-(3-oxobutyl)piperidin-4-one;yttrium?
The canonical SMILES for ethane;1-(3-oxobutyl)piperidin-4-one;yttrium is [CH2-]C.[CH2-]C(=O)CCN1CCC(=O)CC1.[Y].
What is the InChIKey of ethane;1-(3-oxobutyl)piperidin-4-one;yttrium?
The InChIKey is HCGRRWMMRLXYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14NO2.C2H5.Y/c1-8(11)2-5-10-6-3-9(12)4-7-10;1-2;/h1-7H2;1H2,2H3;/q2*-1;.
What are the key properties of ethane;1-(3-oxobutyl)piperidin-4-one;yttrium?
ethane;1-(3-oxobutyl)piperidin-4-one;yttrium has a molecular weight of 286.18 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(3-oxobutyl)piperidin-4-one;yttrium is sourced from PubChem (CID 58101920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).