C6H9BrO2 — CID 58101934
(3aR,6S,6aS)-6-bromo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 58101934) has the molecular formula C6H9BrO2 and a molecular weight of 193.04 g/mol. Its IUPAC name is (3aR,6S,6aS)-6-bromo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3aR,6S,6aS)-6-bromo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 58101934 |
| Molecular Formula | C6H9BrO2 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | (3aR,6S,6aS)-6-bromo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | Br[C@H]1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C6H9BrO2/c7-4-3-9-5-1-2-8-6(4)5/h4-6H,1-3H2/t4-,5+,6+/m0/s1 |
| InChIKey | CXVMCEPBFVYLEI-KVQBGUIXSA-N |
| XLogP | 0.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|