C23H22FN5O2 — CID 58102462
3-[9-[(3-fluoro-5-methylphenyl)methyl]-2-morpholin-4-ylpurin-6-yl]phenol (PubChem CID 58102462) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is 3-[9-[(3-fluoro-5-methylphenyl)methyl]-2-morpholin-4-ylpurin-6-yl]phenol.
| Compound Name | 3-[9-[(3-fluoro-5-methylphenyl)methyl]-2-morpholin-4-ylpurin-6-yl]phenol |
|---|---|
| PubChem CID | 58102462 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 3-[9-[(3-fluoro-5-methylphenyl)methyl]-2-morpholin-4-ylpurin-6-yl]phenol |
| SMILES | Cc1cc(F)cc(Cn2cnc3c(-c4cccc(O)c4)nc(N4CCOCC4)nc32)c1 |
| InChI | InChI=1S/C23H22FN5O2/c1-15-9-16(11-18(24)10-15)13-29-14-25-21-20(17-3-2-4-19(30)12-17)26-23(27-22(21)29)28-5-7-31-8-6-28/h2-4,9-12,14,30H,5-8,13H2,1H3 |
| InChIKey | ICUQOXNPDWHLOW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |