About N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine
N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine (PubChem CID 58102672) has the molecular formula C4H15N2P3
and a molecular weight of 184.10 g/mol. Its IUPAC name is N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 58102672 |
| Molecular Formula | C4H15N2P3 |
| Molecular Weight | 184.10 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)P(P)P |
| InChI | InChI=1S/C4H15N2P3/c1-5-3-4-6(2)9(7)8/h5H,3-4,7-8H2,1-2H3 |
| InChIKey | IYBBJVPNXODRPU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.10 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine (CID 58102672) is N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine is CNCCN(C)P(P)P.
What is the InChIKey of N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine?
The InChIKey is IYBBJVPNXODRPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H15N2P3/c1-5-3-4-6(2)9(7)8/h5H,3-4,7-8H2,1-2H3.
What are the key properties of N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine?
N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine has a molecular weight of 184.10 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-bis(phosphanyl)phosphanyl-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 58102672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).