About (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine
(E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine (PubChem CID 58102833) has the molecular formula C10H10BrNO
and a molecular weight of 240.10 g/mol. Its IUPAC name is (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine |
| PubChem CID | 58102833 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine |
| SMILES | CO/N=C1\CCc2c(Br)cccc21 |
| InChI | InChI=1S/C10H10BrNO/c1-13-12-10-6-5-7-8(10)3-2-4-9(7)11/h2-4H,5-6H2,1H3/b12-10+ |
| InChIKey | FHHVZNNYFVLARV-ZRDIBKRKSA-N |
| XLogP | 2.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine?
The IUPAC name of (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine (CID 58102833) is (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine.
What is the SMILES notation for (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine?
The canonical SMILES for (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine is CO/N=C1\CCc2c(Br)cccc21.
What is the InChIKey of (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine?
The InChIKey is FHHVZNNYFVLARV-ZRDIBKRKSA-N. The full InChI is InChI=1S/C10H10BrNO/c1-13-12-10-6-5-7-8(10)3-2-4-9(7)11/h2-4H,5-6H2,1H3/b12-10+.
What are the key properties of (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine?
(E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine has a molecular weight of 240.10 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-bromo-N-methoxy-2,3-dihydroinden-1-imine is sourced from PubChem (CID 58102833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).