C8H7ClN6 — CID 58103123
6-(2-chloro-3-pyridinyl)-1,2,4-triazine-3,5-diamine (PubChem CID 58103123) has the molecular formula C8H7ClN6 and a molecular weight of 222.64 g/mol. Its IUPAC name is 6-(2-chloro-3-pyridinyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(2-chloro-3-pyridinyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 58103123 |
| Molecular Formula | C8H7ClN6 |
| Molecular Weight | 222.64 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 6-(2-chloro-3-pyridinyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nnc(-c2cccnc2Cl)c(N)n1 |
| InChI | InChI=1S/C8H7ClN6/c9-6-4(2-1-3-12-6)5-7(10)13-8(11)15-14-5/h1-3H,(H4,10,11,13,15) |
| InChIKey | BKMPPQBRQTYMMB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.64 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|