About 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide
3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide (PubChem CID 58103242) has the molecular formula C23H14Cl2FN3O2
and a molecular weight of 454.29 g/mol. Its IUPAC name is 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide.
Molecular Properties
| Compound Name | 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide |
| PubChem CID | 58103242 |
| Molecular Formula | C23H14Cl2FN3O2 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccc(F)nc1)c1cccc(-c2cccc(Oc3cc(Cl)cc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C23H14Cl2FN3O2/c24-16-10-17(25)12-19(11-16)31-22-6-2-5-20(29-22)14-3-1-4-15(9-14)23(30)28-18-7-8-21(26)27-13-18/h1-13H,(H,28,30) |
| InChIKey | VQJVAZTXIVWHLA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide?
The IUPAC name of 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide (CID 58103242) is 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide.
What is the SMILES notation for 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide?
The canonical SMILES for 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide is O=C(Nc1ccc(F)nc1)c1cccc(-c2cccc(Oc3cc(Cl)cc(Cl)c3)n2)c1.
What is the InChIKey of 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide?
The InChIKey is VQJVAZTXIVWHLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14Cl2FN3O2/c24-16-10-17(25)12-19(11-16)31-22-6-2-5-20(29-22)14-3-1-4-15(9-14)23(30)28-18-7-8-21(26)27-13-18/h1-13H,(H,28,30).
What are the key properties of 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide?
3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide has a molecular weight of 454.29 g/mol, XLogP of 6.63, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(3,5-dichlorophenoxy)-2-pyridinyl]-N-(6-fluoro-3-pyridinyl)benzamide is sourced from PubChem (CID 58103242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).