C22H34O3 — CID 58103714
trans-(2R,5S)-2-[(4'R,7'aS)-4'-ethenyl-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexan-1-one (PubChem CID 58103714) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is trans-(2R,5S)-2-[(4'R,7'aS)-4'-ethenyl-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexan-1-one.
| Compound Name | trans-(2R,5S)-2-[(4'R,7'aS)-4'-ethenyl-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 58103714 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | trans-(2R,5S)-2-[(4'R,7'aS)-4'-ethenyl-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexan-1-one |
| SMILES | C=C[C@@H]1C([C@@]2(C)CC[C@H](C)CC2=O)CC[C@@]2(C)C1CCC21OCCO1 |
| InChI | InChI=1S/C22H34O3/c1-5-16-17(20(3)9-6-15(2)14-19(20)23)7-10-21(4)18(16)8-11-22(21)24-12-13-25-22/h5,15-18H,1,6-14H2,2-4H3/t15-,16+,17?,18?,20+,21-/m0/s1 |
| InChIKey | AYZQNZBCNHVKEU-AIGLXODISA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|