C28H40O3Se — CID 58103748
trans-(2R,5S)-2-[(4'R,7'aS)-7'a-methyl-4'-(2-phenylselanylethyl)spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexan-1-one (PubChem CID 58103748) has the molecular formula C28H40O3Se and a molecular weight of 503.59 g/mol. Its IUPAC name is trans-(2R,5S)-2-[(4'R,7'aS)-7'a-methyl-4'-(2-phenylselanylethyl)spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexan-1-one.
| Compound Name | trans-(2R,5S)-2-[(4'R,7'aS)-7'a-methyl-4'-(2-phenylselanylethyl)spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 58103748 |
| Molecular Formula | C28H40O3Se |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | trans-(2R,5S)-2-[(4'R,7'aS)-7'a-methyl-4'-(2-phenylselanylethyl)spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexan-1-one |
| SMILES | C[C@H]1CC[C@](C)(C2CC[C@@]3(C)C(CCC34OCCO4)[C@@H]2CC[Se]c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C28H40O3Se/c1-20-9-13-26(2,25(29)19-20)23-10-14-27(3)24(11-15-28(27)30-16-17-31-28)22(23)12-18-32-21-7-5-4-6-8-21/h4-8,20,22-24H,9-19H2,1-3H3/t20-,22+,23?,24?,26+,27-/m0/s1 |
| InChIKey | DTLBVFCJSLKZPX-BQPYDXPFSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|