C22H34O4 — CID 58103758
2-[(4'R,7'aS)-5'-[(1R,4S)-1,4-dimethyl-2-oxocyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl]acetaldehyde (PubChem CID 58103758) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[(4'R,7'aS)-5'-[(1R,4S)-1,4-dimethyl-2-oxocyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl]acetaldehyde.
| Compound Name | 2-[(4'R,7'aS)-5'-[(1R,4S)-1,4-dimethyl-2-oxocyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl]acetaldehyde |
|---|---|
| PubChem CID | 58103758 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-[(4'R,7'aS)-5'-[(1R,4S)-1,4-dimethyl-2-oxocyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl]acetaldehyde |
| SMILES | C[C@H]1CC[C@](C)(C2CC[C@@]3(C)C(CCC34OCCO4)[C@@H]2CC=O)C(=O)C1 |
| InChI | InChI=1S/C22H34O4/c1-15-4-8-20(2,19(24)14-15)17-5-9-21(3)18(16(17)7-11-23)6-10-22(21)25-12-13-26-22/h11,15-18H,4-10,12-14H2,1-3H3/t15-,16+,17?,18?,20+,21-/m0/s1 |
| InChIKey | XYVQHGLPFZKDHR-AIGLXODISA-N |
| XLogP | 4.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|