C28H52O2Si — CID 58103770
[(4R,7aS)-5-[(1R,2S,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4,5-trimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol (PubChem CID 58103770) has the molecular formula C28H52O2Si and a molecular weight of 448.81 g/mol. Its IUPAC name is [(4R,7aS)-5-[(1R,2S,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4,5-trimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol.
| Compound Name | [(4R,7aS)-5-[(1R,2S,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4,5-trimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol |
|---|---|
| PubChem CID | 58103770 |
| Molecular Formula | C28H52O2Si |
| Molecular Weight | 448.81 g/mol |
| Exact Mass | 448.37 |
| IUPAC Name | [(4R,7aS)-5-[(1R,2S,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4,5-trimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol |
| SMILES | C=C1CCC2[C@H](CO)C([C@@]3(C)C[C@@H](C)[C@@H](C)C[C@@H]3CO[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C28H52O2Si/c1-19-15-22(18-30-31(9,10)26(4,5)6)28(8,16-20(19)2)25-13-14-27(7)21(3)11-12-24(27)23(25)17-29/h19-20,22-25,29H,3,11-18H2,1-2,4-10H3/t19-,20+,22+,23-,24?,25?,27+,28-/m0/s1 |
| InChIKey | JJQCDUACWNUJBH-FZTQGQLBSA-N |
| XLogP | 7.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.81 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|