C30H32F2N2O2 — CID 58104108
1-[6-butoxy-2-propan-2-yl-1-(pyridin-2-ylmethyl)indol-3-yl]-3-(3,4-difluorophenyl)propan-1-one (PubChem CID 58104108) has the molecular formula C30H32F2N2O2 and a molecular weight of 490.59 g/mol. Its IUPAC name is 1-[6-butoxy-2-propan-2-yl-1-(pyridin-2-ylmethyl)indol-3-yl]-3-(3,4-difluorophenyl)propan-1-one.
| Compound Name | 1-[6-butoxy-2-propan-2-yl-1-(pyridin-2-ylmethyl)indol-3-yl]-3-(3,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 58104108 |
| Molecular Formula | C30H32F2N2O2 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 1-[6-butoxy-2-propan-2-yl-1-(pyridin-2-ylmethyl)indol-3-yl]-3-(3,4-difluorophenyl)propan-1-one |
| SMILES | CCCCOc1ccc2c(C(=O)CCc3ccc(F)c(F)c3)c(C(C)C)n(Cc3ccccn3)c2c1 |
| InChI | InChI=1S/C30H32F2N2O2/c1-4-5-16-36-23-11-12-24-27(18-23)34(19-22-8-6-7-15-33-22)30(20(2)3)29(24)28(35)14-10-21-9-13-25(31)26(32)17-21/h6-9,11-13,15,17-18,20H,4-5,10,14,16,19H2,1-3H3 |
| InChIKey | NMGGJSIAEFDAGT-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|