C17H15NO — CID 58104334
6-(3-isocyanophenoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 58104334) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-(3-isocyanophenoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(3-isocyanophenoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 58104334 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 6-(3-isocyanophenoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | [C-]#[N+]c1cccc(Oc2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C17H15NO/c1-18-15-7-4-8-16(12-15)19-17-10-9-13-5-2-3-6-14(13)11-17/h4,7-12H,2-3,5-6H2 |
| InChIKey | YMEAOQZBRFMFTE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|