C27H19F3N2O6 — CID 58104677
2-[2-hydroxy-5-[1,1,1-trifluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 58104677) has the molecular formula C27H19F3N2O6 and a molecular weight of 524.45 g/mol. Its IUPAC name is 2-[2-hydroxy-5-[1,1,1-trifluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[2-hydroxy-5-[1,1,1-trifluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 58104677 |
| Molecular Formula | C27H19F3N2O6 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 2-[2-hydroxy-5-[1,1,1-trifluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1cc(C(C)(c2ccc(O)c(-n3c(=O)c4cc5c(=O)n(C)c(=O)c5cc4c3=O)c2)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C27H19F3N2O6/c1-12-8-13(4-6-20(12)33)26(2,27(28,29)30)14-5-7-21(34)19(9-14)32-24(37)17-10-15-16(11-18(17)25(32)38)23(36)31(3)22(15)35/h4-11,33-34H,1-3H3 |
| InChIKey | AONYLTYETBHAQW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |