C26H27N5 — CID 58105059
(8S)-8-benzyl-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 58105059) has the molecular formula C26H27N5 and a molecular weight of 409.54 g/mol. Its IUPAC name is (8S)-8-benzyl-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | (8S)-8-benzyl-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 58105059 |
| Molecular Formula | C26H27N5 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (8S)-8-benzyl-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cn(-c2ccc(/C=C/c3nc4n(n3)CCC[C@H]4Cc3ccccc3)cc2C)cn1 |
| InChI | InChI=1S/C26H27N5/c1-19-15-22(10-12-24(19)30-17-20(2)27-18-30)11-13-25-28-26-23(9-6-14-31(26)29-25)16-21-7-4-3-5-8-21/h3-5,7-8,10-13,15,17-18,23H,6,9,14,16H2,1-2H3/b13-11+/t23-/m0/s1 |
| InChIKey | RBJDAUGVHYMKQR-BWSGXRDBSA-N |
| XLogP | 5.37 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |