C23H23N5S — CID 58105068
(8S)-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-thiophen-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 58105068) has the molecular formula C23H23N5S and a molecular weight of 401.54 g/mol. Its IUPAC name is (8S)-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-thiophen-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | (8S)-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-thiophen-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 58105068 |
| Molecular Formula | C23H23N5S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (8S)-2-[(E)-2-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-thiophen-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cn(-c2ccc(/C=C/c3nc4n(n3)CCC[C@@H]4c3cccs3)cc2C)cn1 |
| InChI | InChI=1S/C23H23N5S/c1-16-13-18(7-9-20(16)27-14-17(2)24-15-27)8-10-22-25-23-19(21-6-4-12-29-21)5-3-11-28(23)26-22/h4,6-10,12-15,19H,3,5,11H2,1-2H3/b10-8+/t19-/m1/s1 |
| InChIKey | MPEOHHLZASRZOQ-LHUXKHBRSA-N |
| XLogP | 5.24 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |