C24H21F3N6O — CID 58105103
(8S)-2-[(E)-2-[5-methyl-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridin-8-ol (PubChem CID 58105103) has the molecular formula C24H21F3N6O and a molecular weight of 466.47 g/mol. Its IUPAC name is (8S)-2-[(E)-2-[5-methyl-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridin-8-ol.
| Compound Name | (8S)-2-[(E)-2-[5-methyl-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
|---|---|
| PubChem CID | 58105103 |
| Molecular Formula | C24H21F3N6O |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (8S)-2-[(E)-2-[5-methyl-6-(4-methylimidazol-1-yl)-3-pyridinyl]ethenyl]-8-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
| SMILES | Cc1cn(-c2ncc(/C=C/c3nc4n(n3)CCC[C@]4(O)c3cc(F)c(F)c(F)c3)cc2C)cn1 |
| InChI | InChI=1S/C24H21F3N6O/c1-14-8-16(11-28-22(14)32-12-15(2)29-13-32)4-5-20-30-23-24(34,6-3-7-33(23)31-20)17-9-18(25)21(27)19(26)10-17/h4-5,8-13,34H,3,6-7H2,1-2H3/b5-4+/t24-/m0/s1 |
| InChIKey | LEFDUZWCQJTZJZ-JVPDDCAZSA-N |
| XLogP | 4.09 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|