C24H22F2N6O — CID 58105171
(8R)-8-(3,5-difluorophenyl)-2-[(E)-2-[6-methyl-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridin-8-ol (PubChem CID 58105171) has the molecular formula C24H22F2N6O and a molecular weight of 448.48 g/mol. Its IUPAC name is (8R)-8-(3,5-difluorophenyl)-2-[(E)-2-[6-methyl-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridin-8-ol.
| Compound Name | (8R)-8-(3,5-difluorophenyl)-2-[(E)-2-[6-methyl-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
|---|---|
| PubChem CID | 58105171 |
| Molecular Formula | C24H22F2N6O |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (8R)-8-(3,5-difluorophenyl)-2-[(E)-2-[6-methyl-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyridin-8-ol |
| SMILES | Cc1cn(-c2ccc(/C=C/c3nc4n(n3)CCC[C@@]4(O)c3cc(F)cc(F)c3)nc2C)cn1 |
| InChI | InChI=1S/C24H22F2N6O/c1-15-13-31(14-27-15)21-6-4-20(28-16(21)2)5-7-22-29-23-24(33,8-3-9-32(23)30-22)17-10-18(25)12-19(26)11-17/h4-7,10-14,33H,3,8-9H2,1-2H3/b7-5+/t24-/m1/s1 |
| InChIKey | JJTKBTVRNQNQCG-SXBBHYFQSA-N |
| XLogP | 3.95 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |