C19H18Cl3FN2O2 — CID 58105342
[(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 58105342) has the molecular formula C19H18Cl3FN2O2 and a molecular weight of 431.72 g/mol. Its IUPAC name is [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 58105342 |
| Molecular Formula | C19H18Cl3FN2O2 |
| Molecular Weight | 431.72 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | [(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1OCCN(Cc2ccccc2)[C@H]1c1ccc(F)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H18Cl3FN2O2/c20-19(21,22)18(24)27-17-16(14-6-8-15(23)9-7-14)25(10-11-26-17)12-13-4-2-1-3-5-13/h1-9,16-17,24H,10-12H2/b24-18+/t16-,17-/m0/s1 |
| InChIKey | PBADDDKVPYHYHL-IHSGVGNGSA-N |
| XLogP | 5.09 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|