About 5,6-diethyl-1,4-dithian-2-ol
5,6-diethyl-1,4-dithian-2-ol (PubChem CID 58105778) has the molecular formula C8H16OS2
and a molecular weight of 192.35 g/mol. Its IUPAC name is 5,6-diethyl-1,4-dithian-2-ol.
Molecular Properties
| Compound Name | 5,6-diethyl-1,4-dithian-2-ol |
| PubChem CID | 58105778 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 5,6-diethyl-1,4-dithian-2-ol |
| SMILES | CCC1SCC(O)SC1CC |
| InChI | InChI=1S/C8H16OS2/c1-3-6-7(4-2)11-8(9)5-10-6/h6-9H,3-5H2,1-2H3 |
| InChIKey | XQUAVZVBMBIWDY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-diethyl-1,4-dithian-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyl-1,4-dithian-2-ol?
The IUPAC name of 5,6-diethyl-1,4-dithian-2-ol (CID 58105778) is 5,6-diethyl-1,4-dithian-2-ol.
What is the SMILES notation for 5,6-diethyl-1,4-dithian-2-ol?
The canonical SMILES for 5,6-diethyl-1,4-dithian-2-ol is CCC1SCC(O)SC1CC.
What is the InChIKey of 5,6-diethyl-1,4-dithian-2-ol?
The InChIKey is XQUAVZVBMBIWDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS2/c1-3-6-7(4-2)11-8(9)5-10-6/h6-9H,3-5H2,1-2H3.
What are the key properties of 5,6-diethyl-1,4-dithian-2-ol?
5,6-diethyl-1,4-dithian-2-ol has a molecular weight of 192.35 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-1,4-dithian-2-ol is sourced from PubChem (CID 58105778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).