About (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate
(6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 58105791) has the molecular formula C13H21F3O2S2
and a molecular weight of 330.44 g/mol. Its IUPAC name is (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate.
Molecular Properties
| Compound Name | (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate |
| PubChem CID | 58105791 |
| Molecular Formula | C13H21F3O2S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1CSCC(C)(C)CS1)C(F)(F)F |
| InChI | InChI=1S/C13H21F3O2S2/c1-5-12(4,13(14,15)16)10(17)18-9-6-19-7-11(2,3)8-20-9/h9H,5-8H2,1-4H3 |
| InChIKey | OTFHEAOQZFAXEL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The IUPAC name of (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate (CID 58105791) is (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate.
What is the SMILES notation for (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The canonical SMILES for (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate is CCC(C)(C(=O)OC1CSCC(C)(C)CS1)C(F)(F)F.
What is the InChIKey of (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The InChIKey is OTFHEAOQZFAXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3O2S2/c1-5-12(4,13(14,15)16)10(17)18-9-6-19-7-11(2,3)8-20-9/h9H,5-8H2,1-4H3.
What are the key properties of (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate?
(6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate has a molecular weight of 330.44 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6,6-dimethyl-1,4-dithiepan-2-yl) 2-methyl-2-(trifluoromethyl)butanoate is sourced from PubChem (CID 58105791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).