About 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate
1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 58105832) has the molecular formula C11H17F3O2S2
and a molecular weight of 302.38 g/mol. Its IUPAC name is 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate.
Molecular Properties
| Compound Name | 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate |
| PubChem CID | 58105832 |
| Molecular Formula | C11H17F3O2S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1CSCCCS1)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O2S2/c1-3-10(2,11(12,13)14)9(15)16-8-7-17-5-4-6-18-8/h8H,3-7H2,1-2H3 |
| InChIKey | RAIFZFALMNWKOE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate?
The IUPAC name of 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate (CID 58105832) is 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate.
What is the SMILES notation for 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate?
The canonical SMILES for 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate is CCC(C)(C(=O)OC1CSCCCS1)C(F)(F)F.
What is the InChIKey of 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate?
The InChIKey is RAIFZFALMNWKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3O2S2/c1-3-10(2,11(12,13)14)9(15)16-8-7-17-5-4-6-18-8/h8H,3-7H2,1-2H3.
What are the key properties of 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate?
1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate has a molecular weight of 302.38 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dithiepan-2-yl 2-methyl-2-(trifluoromethyl)butanoate is sourced from PubChem (CID 58105832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).