About (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate
(2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate (PubChem CID 58105861) has the molecular formula C11H15F3O2S2
and a molecular weight of 300.37 g/mol. Its IUPAC name is (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 58105861 |
| Molecular Formula | C11H15F3O2S2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC1(C)SCCCSC1C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O2S2/c1-7(11(12,13)14)9(15)16-10(3)8(2)17-5-4-6-18-10/h8H,1,4-6H2,2-3H3 |
| InChIKey | UZOWWYIDZJNMQG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate (CID 58105861) is (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate is C=C(C(=O)OC1(C)SCCCSC1C)C(F)(F)F.
What is the InChIKey of (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is UZOWWYIDZJNMQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3O2S2/c1-7(11(12,13)14)9(15)16-10(3)8(2)17-5-4-6-18-10/h8H,1,4-6H2,2-3H3.
What are the key properties of (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate?
(2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 300.37 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethyl-1,4-dithiepan-2-yl) 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 58105861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).