About [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate
[2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate (PubChem CID 58105947) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate |
| PubChem CID | 58105947 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate |
| SMILES | O=C(CO)OCC(=O)OC1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C16H22O5/c17-6-13(18)20-7-14(19)21-12-5-10-4-11(12)16-9-2-1-8(3-9)15(10)16/h8-12,15-17H,1-7H2 |
| InChIKey | XIEJLVWPGVJPOK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate?
The IUPAC name of [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate (CID 58105947) is [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate.
What is the SMILES notation for [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate?
The canonical SMILES for [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate is O=C(CO)OCC(=O)OC1CC2CC1C1C3CCC(C3)C21.
What is the InChIKey of [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate?
The InChIKey is XIEJLVWPGVJPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O5/c17-6-13(18)20-7-14(19)21-12-5-10-4-11(12)16-9-2-1-8(3-9)15(10)16/h8-12,15-17H,1-7H2.
What are the key properties of [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate?
[2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate has a molecular weight of 294.35 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl] 2-hydroxyacetate is sourced from PubChem (CID 58105947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).