About 2-adamantyl 2-(2-chloroacetyl)oxyacetate
2-adamantyl 2-(2-chloroacetyl)oxyacetate (PubChem CID 58105964) has the molecular formula C14H19ClO4
and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-adamantyl 2-(2-chloroacetyl)oxyacetate.
Molecular Properties
| Compound Name | 2-adamantyl 2-(2-chloroacetyl)oxyacetate |
| PubChem CID | 58105964 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-adamantyl 2-(2-chloroacetyl)oxyacetate |
| SMILES | O=C(CCl)OCC(=O)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H19ClO4/c15-6-12(16)18-7-13(17)19-14-10-2-8-1-9(4-10)5-11(14)3-8/h8-11,14H,1-7H2 |
| InChIKey | ZRJOTMSKWMGJSG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-adamantyl 2-(2-chloroacetyl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyl 2-(2-chloroacetyl)oxyacetate?
The IUPAC name of 2-adamantyl 2-(2-chloroacetyl)oxyacetate (CID 58105964) is 2-adamantyl 2-(2-chloroacetyl)oxyacetate.
What is the SMILES notation for 2-adamantyl 2-(2-chloroacetyl)oxyacetate?
The canonical SMILES for 2-adamantyl 2-(2-chloroacetyl)oxyacetate is O=C(CCl)OCC(=O)OC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-adamantyl 2-(2-chloroacetyl)oxyacetate?
The InChIKey is ZRJOTMSKWMGJSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClO4/c15-6-12(16)18-7-13(17)19-14-10-2-8-1-9(4-10)5-11(14)3-8/h8-11,14H,1-7H2.
What are the key properties of 2-adamantyl 2-(2-chloroacetyl)oxyacetate?
2-adamantyl 2-(2-chloroacetyl)oxyacetate has a molecular weight of 286.76 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyl 2-(2-chloroacetyl)oxyacetate is sourced from PubChem (CID 58105964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).