About 5-methoxy-1,3-dimethylpyrazole
5-methoxy-1,3-dimethylpyrazole (PubChem CID 581065) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 5-methoxy-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-methoxy-1,3-dimethylpyrazole |
| PubChem CID | 581065 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 5-methoxy-1,3-dimethylpyrazole |
| SMILES | COc1cc(C)nn1C |
| InChI | InChI=1S/C6H10N2O/c1-5-4-6(9-3)8(2)7-5/h4H,1-3H3 |
| InChIKey | QGVNQBGVRVIBMA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,3-dimethylpyrazole?
The IUPAC name of 5-methoxy-1,3-dimethylpyrazole (CID 581065) is 5-methoxy-1,3-dimethylpyrazole.
What is the SMILES notation for 5-methoxy-1,3-dimethylpyrazole?
The canonical SMILES for 5-methoxy-1,3-dimethylpyrazole is COc1cc(C)nn1C.
What is the InChIKey of 5-methoxy-1,3-dimethylpyrazole?
The InChIKey is QGVNQBGVRVIBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-5-4-6(9-3)8(2)7-5/h4H,1-3H3.
What are the key properties of 5-methoxy-1,3-dimethylpyrazole?
5-methoxy-1,3-dimethylpyrazole has a molecular weight of 126.16 g/mol, XLogP of 0.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,3-dimethylpyrazole is sourced from PubChem (CID 581065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).