C11H12N2V2-2 — CID 58106705
2,3,5,9,10,10a-hexahydroimidazo[1,2-b]isoquinoline-1,9-diide;bis(vanadium) (PubChem CID 58106705) has the molecular formula C11H12N2V2-2 and a molecular weight of 274.12 g/mol. Its IUPAC name is 2,3,5,9,10,10a-hexahydroimidazo[1,2-b]isoquinoline-1,9-diide;bis(vanadium).
| Compound Name | 2,3,5,9,10,10a-hexahydroimidazo[1,2-b]isoquinoline-1,9-diide;bis(vanadium) |
|---|---|
| PubChem CID | 58106705 |
| Molecular Formula | C11H12N2V2-2 |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2,3,5,9,10,10a-hexahydroimidazo[1,2-b]isoquinoline-1,9-diide;bis(vanadium) |
| SMILES | [V].[V].[c-]1cccc2c1CC1[N-]CCN1C2 |
| InChI | InChI=1S/C11H12N2.2V/c1-2-4-10-8-13-6-5-12-11(13)7-9(10)3-1;;/h1-2,4,11H,5-8H2;;/q-2;; |
| InChIKey | YOYBAQVUEXSXOW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|