About (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum
(Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum (PubChem CID 58106833) has the molecular formula C17H16NO4Pt-
and a molecular weight of 493.40 g/mol. Its IUPAC name is (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum.
Molecular Properties
| Compound Name | (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum |
| PubChem CID | 58106833 |
| Molecular Formula | C17H16NO4Pt- |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(\O)CC(O)c1cccc(Oc2[c-]cccc2)n1.[Pt] |
| InChI | InChI=1S/C17H16NO4.Pt/c1-12(19)10-13(20)11-16(21)15-8-5-9-17(18-15)22-14-6-3-2-4-7-14;/h2-6,8-10,16,20-21H,11H2,1H3;/q-1;/b13-10-; |
| InChIKey | QEDCLKBPCJLHTE-ALUHPYBCSA-N |
| XLogP | 3.13 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum?
The IUPAC name of (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum (CID 58106833) is (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum.
What is the SMILES notation for (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum?
The canonical SMILES for (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum is CC(=O)/C=C(\O)CC(O)c1cccc(Oc2[c-]cccc2)n1.[Pt].
What is the InChIKey of (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum?
The InChIKey is QEDCLKBPCJLHTE-ALUHPYBCSA-N. The full InChI is InChI=1S/C17H16NO4.Pt/c1-12(19)10-13(20)11-16(21)15-8-5-9-17(18-15)22-14-6-3-2-4-7-14;/h2-6,8-10,16,20-21H,11H2,1H3;/q-1;/b13-10-;.
What are the key properties of (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum?
(Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum has a molecular weight of 493.40 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4,6-dihydroxy-6-[6-(phenoxy)-2-pyridinyl]hex-3-en-2-one;platinum is sourced from PubChem (CID 58106833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).