About N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+)
N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+) (PubChem CID 58106856) has the molecular formula C13H13N2OOs
and a molecular weight of 403.49 g/mol. Its IUPAC name is N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+).
Molecular Properties
| Compound Name | N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+) |
| PubChem CID | 58106856 |
| Molecular Formula | C13H13N2OOs |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+) |
| SMILES | CNCc1cccc(Oc2[c-]cccc2)n1.[Os+] |
| InChI | InChI=1S/C13H13N2O.Os/c1-14-10-11-6-5-9-13(15-11)16-12-7-3-2-4-8-12;/h2-7,9,14H,10H2,1H3;/q-1;+1 |
| InChIKey | KSCNDBMEPIQGIY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+)?
The IUPAC name of N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+) (CID 58106856) is N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+).
What is the SMILES notation for N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+)?
The canonical SMILES for N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+) is CNCc1cccc(Oc2[c-]cccc2)n1.[Os+].
What is the InChIKey of N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+)?
The InChIKey is KSCNDBMEPIQGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N2O.Os/c1-14-10-11-6-5-9-13(15-11)16-12-7-3-2-4-8-12;/h2-7,9,14H,10H2,1H3;/q-1;+1.
What are the key properties of N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+)?
N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+) has a molecular weight of 403.49 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[6-(phenoxy)-2-pyridinyl]methanamine;osmium(1+) is sourced from PubChem (CID 58106856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).