About 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium
1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium (PubChem CID 58106905) has the molecular formula C16H22IrN2-2
and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium.
Molecular Properties
| Compound Name | 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium |
| PubChem CID | 58106905 |
| Molecular Formula | C16H22IrN2-2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium |
| SMILES | CCN1[CH-]N(C(C)(C)c2[c-]cccc2)C(C)=C1C.[Ir] |
| InChI | InChI=1S/C16H22N2.Ir/c1-6-17-12-18(14(3)13(17)2)16(4,5)15-10-8-7-9-11-15;/h7-10,12H,6H2,1-5H3;/q-2; |
| InChIKey | NJAIXIJFRCLQNT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium?
The IUPAC name of 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium (CID 58106905) is 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium.
What is the SMILES notation for 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium?
The canonical SMILES for 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium is CCN1[CH-]N(C(C)(C)c2[c-]cccc2)C(C)=C1C.[Ir].
What is the InChIKey of 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium?
The InChIKey is NJAIXIJFRCLQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2.Ir/c1-6-17-12-18(14(3)13(17)2)16(4,5)15-10-8-7-9-11-15;/h7-10,12H,6H2,1-5H3;/q-2;.
What are the key properties of 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium?
1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium has a molecular weight of 434.58 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,5-dimethyl-3-(2-phenylpropan-2-yl)-2H-imidazol-2-ide;iridium is sourced from PubChem (CID 58106905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).