About 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium
3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium (PubChem CID 58106945) has the molecular formula C13H17IrN3-2
and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium.
Molecular Properties
| Compound Name | 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium |
| PubChem CID | 58106945 |
| Molecular Formula | C13H17IrN3-2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium |
| SMILES | CCN1C=CN(C(C)(C)c2[c-]nccc2)[CH-]1.[Ir] |
| InChI | InChI=1S/C13H17N3.Ir/c1-4-15-8-9-16(11-15)13(2,3)12-6-5-7-14-10-12;/h5-9,11H,4H2,1-3H3;/q-2; |
| InChIKey | ZVHBMSPHQMLAJN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium?
The IUPAC name of 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium (CID 58106945) is 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium.
What is the SMILES notation for 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium?
The canonical SMILES for 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium is CCN1C=CN(C(C)(C)c2[c-]nccc2)[CH-]1.[Ir].
What is the InChIKey of 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium?
The InChIKey is ZVHBMSPHQMLAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3.Ir/c1-4-15-8-9-16(11-15)13(2,3)12-6-5-7-14-10-12;/h5-9,11H,4H2,1-3H3;/q-2;.
What are the key properties of 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium?
3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium has a molecular weight of 407.52 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-ethyl-2H-imidazol-2-id-1-yl)propan-2-yl]-2H-pyridin-2-ide;iridium is sourced from PubChem (CID 58106945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).