About (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium
(Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium (PubChem CID 58107056) has the molecular formula C18H18IrNO3-
and a molecular weight of 488.56 g/mol. Its IUPAC name is (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium.
Molecular Properties
| Compound Name | (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium |
| PubChem CID | 58107056 |
| Molecular Formula | C18H18IrNO3- |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(\O)CC(C)c1cccc(Oc2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C18H18NO3.Ir/c1-13(11-15(21)12-14(2)20)17-9-6-10-18(19-17)22-16-7-4-3-5-8-16;/h3-7,9-10,12-13,21H,11H2,1-2H3;/q-1;/b15-12-; |
| InChIKey | YYZYCTYMBGIZTP-OBBOLZQKSA-N |
| XLogP | 4.20 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium?
The IUPAC name of (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium (CID 58107056) is (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium.
What is the SMILES notation for (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium?
The canonical SMILES for (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium is CC(=O)/C=C(\O)CC(C)c1cccc(Oc2[c-]cccc2)n1.[Ir].
What is the InChIKey of (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium?
The InChIKey is YYZYCTYMBGIZTP-OBBOLZQKSA-N. The full InChI is InChI=1S/C18H18NO3.Ir/c1-13(11-15(21)12-14(2)20)17-9-6-10-18(19-17)22-16-7-4-3-5-8-16;/h3-7,9-10,12-13,21H,11H2,1-2H3;/q-1;/b15-12-;.
What are the key properties of (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium?
(Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium has a molecular weight of 488.56 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydroxy-6-[6-(phenoxy)-2-pyridinyl]hept-3-en-2-one;iridium is sourced from PubChem (CID 58107056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).