C22H26N4S — CID 58107329
3-methyl-2-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]aniline (PubChem CID 58107329) has the molecular formula C22H26N4S and a molecular weight of 378.55 g/mol. Its IUPAC name is 3-methyl-2-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]aniline.
| Compound Name | 3-methyl-2-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]aniline |
|---|---|
| PubChem CID | 58107329 |
| Molecular Formula | C22H26N4S |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-methyl-2-[4-[(2-phenyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]aniline |
| SMILES | Cc1cccc(N)c1N1CCCN(Cc2csc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C22H26N4S/c1-17-7-5-10-20(23)21(17)26-12-6-11-25(13-14-26)15-19-16-27-22(24-19)18-8-3-2-4-9-18/h2-5,7-10,16H,6,11-15,23H2,1H3 |
| InChIKey | KLZDKBNLWFEOCX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|