C22H32F2O6 — CID 58108106
spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 7-(2,2-difluoropropanoyloxy)heptanoate (PubChem CID 58108106) has the molecular formula C22H32F2O6 and a molecular weight of 430.49 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 7-(2,2-difluoropropanoyloxy)heptanoate.
| Compound Name | spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 7-(2,2-difluoropropanoyloxy)heptanoate |
|---|---|
| PubChem CID | 58108106 |
| Molecular Formula | C22H32F2O6 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 7-(2,2-difluoropropanoyloxy)heptanoate |
| SMILES | CC(F)(F)C(=O)OCCCCCCC(=O)OC12CC3CC(C1)C1(OCCO1)C(C3)C2 |
| InChI | InChI=1S/C22H32F2O6/c1-20(23,24)19(26)27-7-5-3-2-4-6-18(25)30-21-12-15-10-16(13-21)22(17(11-15)14-21)28-8-9-29-22/h15-17H,2-14H2,1H3 |
| InChIKey | FTQKWSBTDQHMNT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|