About spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate
spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate (PubChem CID 58108122) has the molecular formula C16H23FO4
and a molecular weight of 298.35 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate.
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate |
| PubChem CID | 58108122 |
| Molecular Formula | C16H23FO4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate |
| SMILES | CC(C)(F)C(=O)OC12CC3CC(C1)C1(OCCO1)C(C3)C2 |
| InChI | InChI=1S/C16H23FO4/c1-14(2,17)13(18)21-15-7-10-5-11(8-15)16(12(6-10)9-15)19-3-4-20-16/h10-12H,3-9H2,1-2H3 |
| InChIKey | UZHMOJAISCKWIA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate?
The IUPAC name of spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate (CID 58108122) is spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate.
What is the SMILES notation for spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate?
The canonical SMILES for spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate is CC(C)(F)C(=O)OC12CC3CC(C1)C1(OCCO1)C(C3)C2.
What is the InChIKey of spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate?
The InChIKey is UZHMOJAISCKWIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23FO4/c1-14(2,17)13(18)21-15-7-10-5-11(8-15)16(12(6-10)9-15)19-3-4-20-16/h10-12H,3-9H2,1-2H3.
What are the key properties of spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate?
spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate has a molecular weight of 298.35 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 2-fluoro-2-methylpropanoate is sourced from PubChem (CID 58108122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).