C10H10F6O3S — CID 58108182
3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 58108182) has the molecular formula C10H10F6O3S and a molecular weight of 324.24 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58108182 |
| Molecular Formula | C10H10F6O3S |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C10H10F6O3S/c11-8(12,7-4-5-1-2-6(7)3-5)9(13,14)10(15,16)20(17,18)19/h1-2,5-7H,3-4H2,(H,17,18,19) |
| InChIKey | KMDUVQHMTPBTNT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|