About N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide
N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide (PubChem CID 58108224) has the molecular formula C15H25NO4S
and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide.
Molecular Properties
| Compound Name | N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide |
| PubChem CID | 58108224 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NS(=O)(=O)CC1CC2CC(=O)C1C2(C)C |
| InChI | InChI=1S/C15H25NO4S/c1-5-9(2)14(18)16-21(19,20)8-10-6-11-7-12(17)13(10)15(11,3)4/h9-11,13H,5-8H2,1-4H3,(H,16,18) |
| InChIKey | UGPAUWZSUBFQSV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide?
The IUPAC name of N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide (CID 58108224) is N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide.
What is the SMILES notation for N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide?
The canonical SMILES for N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide is CCC(C)C(=O)NS(=O)(=O)CC1CC2CC(=O)C1C2(C)C.
What is the InChIKey of N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide?
The InChIKey is UGPAUWZSUBFQSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO4S/c1-5-9(2)14(18)16-21(19,20)8-10-6-11-7-12(17)13(10)15(11,3)4/h9-11,13H,5-8H2,1-4H3,(H,16,18).
What are the key properties of N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide?
N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide has a molecular weight of 315.44 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(7,7-dimethyl-6-oxo-2-bicyclo[2.2.1]heptanyl)methylsulfonyl]-2-methylbutanamide is sourced from PubChem (CID 58108224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).