About 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium)
4-methoxybenzene-3,5-diid-1-amine;bis(yttrium) (PubChem CID 58108283) has the molecular formula C7H7NOY2-2
and a molecular weight of 298.95 g/mol. Its IUPAC name is 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium).
Molecular Properties
| Compound Name | 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium) |
| PubChem CID | 58108283 |
| Molecular Formula | C7H7NOY2-2 |
| Molecular Weight | 298.95 g/mol |
| Exact Mass | 298.87 |
| IUPAC Name | 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium) |
| SMILES | COc1[c-]cc(N)c[c-]1.[Y].[Y] |
| InChI | InChI=1S/C7H7NO.2Y/c1-9-7-4-2-6(8)3-5-7;;/h2-3H,8H2,1H3;;/q-2;; |
| InChIKey | KCMBMOZWMWYSMZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.95 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium)?
The IUPAC name of 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium) (CID 58108283) is 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium).
What is the SMILES notation for 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium)?
The canonical SMILES for 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium) is COc1[c-]cc(N)c[c-]1.[Y].[Y].
What is the InChIKey of 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium)?
The InChIKey is KCMBMOZWMWYSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.2Y/c1-9-7-4-2-6(8)3-5-7;;/h2-3H,8H2,1H3;;/q-2;;.
What are the key properties of 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium)?
4-methoxybenzene-3,5-diid-1-amine;bis(yttrium) has a molecular weight of 298.95 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzene-3,5-diid-1-amine;bis(yttrium) is sourced from PubChem (CID 58108283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).