C16H28N2O4S — CID 58108293
tert-butyl 3-[(3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbonyl)amino]propanoate (PubChem CID 58108293) has the molecular formula C16H28N2O4S and a molecular weight of 344.48 g/mol. Its IUPAC name is tert-butyl 3-[(3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbonyl)amino]propanoate.
| Compound Name | tert-butyl 3-[(3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 58108293 |
| Molecular Formula | C16H28N2O4S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | tert-butyl 3-[(3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbonyl)amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNC(=O)C1N(C=O)C(C)(C)SC1(C)C |
| InChI | InChI=1S/C16H28N2O4S/c1-14(2,3)22-11(20)8-9-17-13(21)12-15(4,5)23-16(6,7)18(12)10-19/h10,12H,8-9H2,1-7H3,(H,17,21) |
| InChIKey | YVKZMAWTRGWOTM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|