C21H30O4 — CID 58108373
(1R,2S,6R,10S,11R,13S,15R)-8-ethyl-1,6,13-trihydroxy-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one (PubChem CID 58108373) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1R,2S,6R,10S,11R,13S,15R)-8-ethyl-1,6,13-trihydroxy-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one.
| Compound Name | (1R,2S,6R,10S,11R,13S,15R)-8-ethyl-1,6,13-trihydroxy-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
|---|---|
| PubChem CID | 58108373 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (1R,2S,6R,10S,11R,13S,15R)-8-ethyl-1,6,13-trihydroxy-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
| SMILES | CCC1=C[C@H]2[C@@H]3C(C)(C)[C@]3(O)C[C@@H](C)[C@]2(O)[C@@H]2C=C(C)C(=O)[C@@]2(O)C1 |
| InChI | InChI=1S/C21H30O4/c1-6-13-8-14-16-18(4,5)20(16,24)9-12(3)21(14,25)15-7-11(2)17(22)19(15,23)10-13/h7-8,12,14-16,23-25H,6,9-10H2,1-5H3/t12-,14+,15-,16-,19-,20+,21-/m1/s1 |
| InChIKey | QAHNXTGCKUCDAD-YBGITETOSA-N |
| XLogP | 2.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|