C24H54O8Si4 — CID 58108481
1-O-(2-hydroxyethyl) 5-O-[3-tris(trimethylsilyloxy)silylpropyl] 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 58108481) has the molecular formula C24H54O8Si4 and a molecular weight of 583.03 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-[3-tris(trimethylsilyloxy)silylpropyl] 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-[3-tris(trimethylsilyloxy)silylpropyl] 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 58108481 |
| Molecular Formula | C24H54O8Si4 |
| Molecular Weight | 583.03 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-[3-tris(trimethylsilyloxy)silylpropyl] 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCO)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H54O8Si4/c1-14-24(4,20-23(2,3)21(26)29-18-16-25)22(27)28-17-15-19-36(30-33(5,6)7,31-34(8,9)10)32-35(11,12)13/h25H,14-20H2,1-13H3 |
| InChIKey | VJNGJFDNRDQUNJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.03 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|