C12H21N — CID 58108485
2,2,3,3,4,5,6-heptamethylpyridine (PubChem CID 58108485) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 2,2,3,3,4,5,6-heptamethylpyridine.
| Compound Name | 2,2,3,3,4,5,6-heptamethylpyridine |
|---|---|
| PubChem CID | 58108485 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2,2,3,3,4,5,6-heptamethylpyridine |
| SMILES | CC1=NC(C)(C)C(C)(C)C(C)=C1C |
| InChI | InChI=1S/C12H21N/c1-8-9(2)11(4,5)12(6,7)13-10(8)3/h1-7H3 |
| InChIKey | UQDDJCWNNODROU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |