C16H26N2O8 — CID 581089
1,4,7,15-tetraoxa-12,18-diazacyclodocosane-8,11,19,22-tetrone (PubChem CID 581089) has the molecular formula C16H26N2O8 and a molecular weight of 374.39 g/mol. Its IUPAC name is 1,4,7,15-tetraoxa-12,18-diazacyclodocosane-8,11,19,22-tetrone.
| Compound Name | 1,4,7,15-tetraoxa-12,18-diazacyclodocosane-8,11,19,22-tetrone |
|---|---|
| PubChem CID | 581089 |
| Molecular Formula | C16H26N2O8 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1,4,7,15-tetraoxa-12,18-diazacyclodocosane-8,11,19,22-tetrone |
| SMILES | O=C1CCC(=O)OCCOCCOC(=O)CCC(=O)NCCOCCN1 |
| InChI | InChI=1S/C16H26N2O8/c19-13-1-3-15(21)25-11-9-24-10-12-26-16(22)4-2-14(20)18-6-8-23-7-5-17-13/h1-12H2,(H,17,19)(H,18,20) |
| InChIKey | RZLBZDBGIGWXGD-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |