About 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate
2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate (PubChem CID 58109084) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate.
Molecular Properties
| Compound Name | 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate |
| PubChem CID | 58109084 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate |
| SMILES | CCCN(CC(C)C)C(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C15H31NO2/c1-8-9-16(10-11(2)3)15(17)18-14(12(4)5)13(6)7/h11-14H,8-10H2,1-7H3 |
| InChIKey | KHWQEMBDYPVQGZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate?
The IUPAC name of 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate (CID 58109084) is 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate.
What is the SMILES notation for 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate?
The canonical SMILES for 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate is CCCN(CC(C)C)C(=O)OC(C(C)C)C(C)C.
What is the InChIKey of 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate?
The InChIKey is KHWQEMBDYPVQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2/c1-8-9-16(10-11(2)3)15(17)18-14(12(4)5)13(6)7/h11-14H,8-10H2,1-7H3.
What are the key properties of 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate?
2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate has a molecular weight of 257.42 g/mol, XLogP of 4.17, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-3-yl N-(2-methylpropyl)-N-propylcarbamate is sourced from PubChem (CID 58109084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).