About 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol
5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol (PubChem CID 58109152) has the molecular formula C22H21F2NO
and a molecular weight of 353.41 g/mol. Its IUPAC name is 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol.
Molecular Properties
| Compound Name | 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol |
| PubChem CID | 58109152 |
| Molecular Formula | C22H21F2NO |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol |
| SMILES | CC(O)(CCCc1cccc(-c2ccc(F)cc2F)c1)c1ccccn1 |
| InChI | InChI=1S/C22H21F2NO/c1-22(26,21-9-2-3-13-25-21)12-5-7-16-6-4-8-17(14-16)19-11-10-18(23)15-20(19)24/h2-4,6,8-11,13-15,26H,5,7,12H2,1H3 |
| InChIKey | DCSNRRIGGQCXPA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol?
The IUPAC name of 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol (CID 58109152) is 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol.
What is the SMILES notation for 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol?
The canonical SMILES for 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol is CC(O)(CCCc1cccc(-c2ccc(F)cc2F)c1)c1ccccn1.
What is the InChIKey of 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol?
The InChIKey is DCSNRRIGGQCXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F2NO/c1-22(26,21-9-2-3-13-25-21)12-5-7-16-6-4-8-17(14-16)19-11-10-18(23)15-20(19)24/h2-4,6,8-11,13-15,26H,5,7,12H2,1H3.
What are the key properties of 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol?
5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol has a molecular weight of 353.41 g/mol, XLogP of 5.26, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(2,4-difluorophenyl)phenyl]-2-pyridin-2-ylpentan-2-ol is sourced from PubChem (CID 58109152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).