C27H30FN3O4S — CID 58109188
N-[3-[(6R)-6-(4-fluorophenyl)-2-oxo-3-[(1S)-1-(4-pyridin-2-ylphenyl)ethyl]-1,3-oxazinan-6-yl]propyl]methanesulfonamide (PubChem CID 58109188) has the molecular formula C27H30FN3O4S and a molecular weight of 511.62 g/mol. Its IUPAC name is N-[3-[(6R)-6-(4-fluorophenyl)-2-oxo-3-[(1S)-1-(4-pyridin-2-ylphenyl)ethyl]-1,3-oxazinan-6-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[(6R)-6-(4-fluorophenyl)-2-oxo-3-[(1S)-1-(4-pyridin-2-ylphenyl)ethyl]-1,3-oxazinan-6-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 58109188 |
| Molecular Formula | C27H30FN3O4S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[3-[(6R)-6-(4-fluorophenyl)-2-oxo-3-[(1S)-1-(4-pyridin-2-ylphenyl)ethyl]-1,3-oxazinan-6-yl]propyl]methanesulfonamide |
| SMILES | C[C@@H](c1ccc(-c2ccccn2)cc1)N1CC[C@](CCCNS(C)(=O)=O)(c2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C27H30FN3O4S/c1-20(21-7-9-22(10-8-21)25-6-3-4-17-29-25)31-19-16-27(35-26(31)32,15-5-18-30-36(2,33)34)23-11-13-24(28)14-12-23/h3-4,6-14,17,20,30H,5,15-16,18-19H2,1-2H3/t20-,27+/m0/s1 |
| InChIKey | OLVKUAWPBRUBKQ-CCLHPLFOSA-N |
| XLogP | 5.02 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|